C20H20N4O2S3 — CID 19318169
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 19318169) has the molecular formula C20H20N4O2S3 and a molecular weight of 444.61 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19318169 |
| Molecular Formula | C20H20N4O2S3 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SCC(=O)Nc2nc(C)cs2)c1 |
| InChI | InChI=1S/C20H20N4O2S3/c1-13-11-29-20(21-13)24-18(25)12-28-15-7-5-6-14(10-15)22-19(27)23-16-8-3-4-9-17(16)26-2/h3-11H,12H2,1-2H3,(H,21,24,25)(H2,22,23,27) |
| InChIKey | SFDSTRPLRCOJHB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|