C22H20ClN3O2S2 — CID 19316382
N-(5-chloro-2-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19316382) has the molecular formula C22H20ClN3O2S2 and a molecular weight of 458.01 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316382 |
| Molecular Formula | C22H20ClN3O2S2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1cccc(NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H20ClN3O2S2/c1-28-20-11-10-15(23)12-19(20)26-21(27)14-30-18-9-5-8-17(13-18)25-22(29)24-16-6-3-2-4-7-16/h2-13H,14H2,1H3,(H,26,27)(H2,24,25,29) |
| InChIKey | APDRLKUHNQSXSY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|