C21H17Cl2N3OS2 — CID 19316337
N-(2,4-dichlorophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19316337) has the molecular formula C21H17Cl2N3OS2 and a molecular weight of 462.43 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316337 |
| Molecular Formula | C21H17Cl2N3OS2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1cccc(NC(=S)Nc2ccccc2)c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl2N3OS2/c22-14-9-10-19(18(23)11-14)26-20(27)13-29-17-8-4-7-16(12-17)25-21(28)24-15-5-2-1-3-6-15/h1-12H,13H2,(H,26,27)(H2,24,25,28) |
| InChIKey | YHBUHPNSGXQVEN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|