C21H18ClN3OS2 — CID 19712782
N-(2-chlorophenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19712782) has the molecular formula C21H18ClN3OS2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712782 |
| Molecular Formula | C21H18ClN3OS2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(NC(=S)Nc2ccccc2)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H18ClN3OS2/c22-18-8-4-5-9-19(18)25-20(26)14-28-17-12-10-16(11-13-17)24-21(27)23-15-6-2-1-3-7-15/h1-13H,14H2,(H,25,26)(H2,23,24,27) |
| InChIKey | LVRCWXLSPJVFBW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|