C24H24ClN3O2S2 — CID 19316839
N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide (PubChem CID 19316839) has the molecular formula C24H24ClN3O2S2 and a molecular weight of 486.06 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316839 |
| Molecular Formula | C24H24ClN3O2S2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C)C(=O)Nc2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C24H24ClN3O2S2/c1-15-11-12-17(25)13-21(15)27-23(29)16(2)32-19-8-6-7-18(14-19)26-24(31)28-20-9-4-5-10-22(20)30-3/h4-14,16H,1-3H3,(H,27,29)(H2,26,28,31) |
| InChIKey | WZWUTGXNEQLNTD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|