C24H24N4O4S2 — CID 19316875
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-4-nitrophenyl)propanamide (PubChem CID 19316875) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-4-nitrophenyl)propanamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 19316875 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-4-nitrophenyl)propanamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2C)c1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-15-13-18(28(30)31)11-12-20(15)26-23(29)16(2)34-19-8-6-7-17(14-19)25-24(33)27-21-9-4-5-10-22(21)32-3/h4-14,16H,1-3H3,(H,26,29)(H2,25,27,33) |
| InChIKey | ZCEKVNTVXPQNCF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|