C25H27N3O4S2 — CID 19316863
N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide (PubChem CID 19316863) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316863 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
| SMILES | COc1ccc(NC(=O)C(C)Sc2cccc(NC(=S)Nc3ccccc3OC)c2)c(OC)c1 |
| InChI | InChI=1S/C25H27N3O4S2/c1-16(24(29)27-21-13-12-18(30-2)15-23(21)32-4)34-19-9-7-8-17(14-19)26-25(33)28-20-10-5-6-11-22(20)31-3/h5-16H,1-4H3,(H,27,29)(H2,26,28,33) |
| InChIKey | BLQREZHRXGZPOK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|