C25H26N4O4S2 — CID 19317020
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)butanamide (PubChem CID 19317020) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)butanamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 19317020 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccccc2OC)c1)C(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C25H26N4O4S2/c1-4-23(24(30)27-21-15-18(29(31)32)13-12-16(21)2)35-19-9-7-8-17(14-19)26-25(34)28-20-10-5-6-11-22(20)33-3/h5-15,23H,4H2,1-3H3,(H,27,30)(H2,26,28,34) |
| InChIKey | NYJJSXMBZQMSFI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|