C28H24ClN3O2S2 — CID 19317051
N-(4-chlorophenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide (PubChem CID 19317051) has the molecular formula C28H24ClN3O2S2 and a molecular weight of 534.11 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 19317051 |
| Molecular Formula | C28H24ClN3O2S2 |
| Molecular Weight | 534.11 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C(=O)Nc2ccc(Cl)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H24ClN3O2S2/c1-34-25-13-6-5-12-24(25)32-28(35)31-22-10-7-11-23(18-22)36-26(19-8-3-2-4-9-19)27(33)30-21-16-14-20(29)15-17-21/h2-18,26H,1H3,(H,30,33)(H2,31,32,35) |
| InChIKey | VHMNXCRSXKKODG-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.11 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|