C28H26N4O4S3 — CID 19317104
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-(4-sulfamoylphenyl)acetamide (PubChem CID 19317104) has the molecular formula C28H26N4O4S3 and a molecular weight of 578.74 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 19317104 |
| Molecular Formula | C28H26N4O4S3 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C(=O)Nc2ccc(S(N)(=O)=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H26N4O4S3/c1-36-25-13-6-5-12-24(25)32-28(37)31-21-10-7-11-22(18-21)38-26(19-8-3-2-4-9-19)27(33)30-20-14-16-23(17-15-20)39(29,34)35/h2-18,26H,1H3,(H,30,33)(H2,29,34,35)(H2,31,32,37) |
| InChIKey | UKZYXQBYWWUPIE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|