C22H22N4O3S3 — CID 19316312
2-[3-(phenylcarbamothioylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 19316312) has the molecular formula C22H22N4O3S3 and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[3-(phenylcarbamothioylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-[3-(phenylcarbamothioylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 19316312 |
| Molecular Formula | C22H22N4O3S3 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-[3-(phenylcarbamothioylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(Sc1cccc(NC(=S)Nc2ccccc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N4O3S3/c1-15(21(27)24-17-10-12-20(13-11-17)32(23,28)29)31-19-9-5-8-18(14-19)26-22(30)25-16-6-3-2-4-7-16/h2-15H,1H3,(H,24,27)(H2,23,28,29)(H2,25,26,30) |
| InChIKey | KSWXVTVIQKMZBP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|