C31H28ClN3O3S2 — CID 19317360
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-phenylacetamide (PubChem CID 19317360) has the molecular formula C31H28ClN3O3S2 and a molecular weight of 590.17 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-phenylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19317360 |
| Molecular Formula | C31H28ClN3O3S2 |
| Molecular Weight | 590.17 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-phenylacetamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(Sc1cccc(NC(=S)Nc2ccc(C(C)=O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H28ClN3O3S2/c1-19-16-27(28(38-3)18-26(19)32)35-30(37)29(22-8-5-4-6-9-22)40-25-11-7-10-24(17-25)34-31(39)33-23-14-12-21(13-15-23)20(2)36/h4-18,29H,1-3H3,(H,35,37)(H2,33,34,39) |
| InChIKey | FAAXCNQNJRCVMT-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.17 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|