C28H24N4O2S2 — CID 19318265
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-2-ylacetamide (PubChem CID 19318265) has the molecular formula C28H24N4O2S2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-2-ylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 19318265 |
| Molecular Formula | C28H24N4O2S2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-2-ylacetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C(=O)Nc3ccccn3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H24N4O2S2/c1-19(33)20-13-15-22(16-14-20)30-28(35)31-23-10-7-11-24(18-23)36-26(21-8-3-2-4-9-21)27(34)32-25-12-5-6-17-29-25/h2-18,26H,1H3,(H,29,32,34)(H2,30,31,35) |
| InChIKey | DNMKMHZZVDULCT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|