C19H16N2OS — CID 40546464
(2S)-2-phenyl-2-phenylsulfanyl-N-pyridin-2-ylacetamide (PubChem CID 40546464) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is (2S)-2-phenyl-2-phenylsulfanyl-N-pyridin-2-ylacetamide.
| Compound Name | (2S)-2-phenyl-2-phenylsulfanyl-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 40546464 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2S)-2-phenyl-2-phenylsulfanyl-N-pyridin-2-ylacetamide |
| SMILES | O=C(Nc1ccccn1)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2OS/c22-19(21-17-13-7-8-14-20-17)18(15-9-3-1-4-10-15)23-16-11-5-2-6-12-16/h1-14,18H,(H,20,21,22)/t18-/m0/s1 |
| InChIKey | FMHVLVMRHSOZDT-SFHVURJKSA-N |
| XLogP | 4.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |