C24H19N3O2S2 — CID 22781894
N-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 22781894) has the molecular formula C24H19N3O2S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22781894 |
| Molecular Formula | C24H19N3O2S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccccn2)c2ccccc2)cc1)c1cccs1 |
| InChI | InChI=1S/C24H19N3O2S2/c28-23(20-9-6-16-30-20)26-18-11-13-19(14-12-18)31-22(17-7-2-1-3-8-17)24(29)27-21-10-4-5-15-25-21/h1-16,22H,(H,26,28)(H,25,27,29) |
| InChIKey | DFOYLLHZSGGAEB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |