C19H16N2O2S2 — CID 7600839
N'-[(2S)-2-phenyl-2-phenylsulfanylacetyl]thiophene-2-carbohydrazide (PubChem CID 7600839) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N'-[(2S)-2-phenyl-2-phenylsulfanylacetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[(2S)-2-phenyl-2-phenylsulfanylacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 7600839 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N'-[(2S)-2-phenyl-2-phenylsulfanylacetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H](Sc1ccccc1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H16N2O2S2/c22-18(16-12-7-13-24-16)20-21-19(23)17(14-8-3-1-4-9-14)25-15-10-5-2-6-11-15/h1-13,17H,(H,20,22)(H,21,23)/t17-/m0/s1 |
| InChIKey | OSWLRLUOVUPYBA-KRWDZBQOSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|