C26H21N3O3S2 — CID 18906394
N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 18906394) has the molecular formula C26H21N3O3S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18906394 |
| Molecular Formula | C26H21N3O3S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)c3cccs3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O3S2/c27-24(30)18-11-13-19(14-12-18)28-26(32)23(17-6-2-1-3-7-17)34-21-9-4-8-20(16-21)29-25(31)22-10-5-15-33-22/h1-16,23H,(H2,27,30)(H,28,32)(H,29,31) |
| InChIKey | DVLQEEBGCXSCFB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |