C28H22FN3O3S — CID 18904090
N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2-fluorobenzamide (PubChem CID 18904090) has the molecular formula C28H22FN3O3S and a molecular weight of 499.57 g/mol. Its IUPAC name is N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2-fluorobenzamide.
| Compound Name | N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 18904090 |
| Molecular Formula | C28H22FN3O3S |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[3-[2-(4-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)c3ccccc3F)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22FN3O3S/c29-24-12-5-4-11-23(24)27(34)32-21-9-6-10-22(17-21)36-25(18-7-2-1-3-8-18)28(35)31-20-15-13-19(14-16-20)26(30)33/h1-17,25H,(H2,30,33)(H,31,35)(H,32,34) |
| InChIKey | CCNDAVKRYLVXKU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |