C26H20FN3O2S — CID 23095078
2-fluoro-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide (PubChem CID 23095078) has the molecular formula C26H20FN3O2S and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-fluoro-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 23095078 |
| Molecular Formula | C26H20FN3O2S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-fluoro-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccncc2)c2ccccc2)cc1)c1ccccc1F |
| InChI | InChI=1S/C26H20FN3O2S/c27-23-9-5-4-8-22(23)25(31)29-19-10-12-21(13-11-19)33-24(18-6-2-1-3-7-18)26(32)30-20-14-16-28-17-15-20/h1-17,24H,(H,29,31)(H,28,30,32) |
| InChIKey | VGBYEXMBEFAYIS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |