C27H23N3O2S — CID 22782953
4-methyl-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide (PubChem CID 22782953) has the molecular formula C27H23N3O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is 4-methyl-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-methyl-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 22782953 |
| Molecular Formula | C27H23N3O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-methyl-N-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(SC(C(=O)Nc3ccncc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H23N3O2S/c1-19-7-9-21(10-8-19)26(31)29-22-11-13-24(14-12-22)33-25(20-5-3-2-4-6-20)27(32)30-23-15-17-28-18-16-23/h2-18,25H,1H3,(H,29,31)(H,28,30,32) |
| InChIKey | YHEPKKYAJWZHKW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |