C29H24N2O4S — CID 23099709
3-[[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 23099709) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 3-[[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23099709 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-[[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(SC(C(=O)Nc3cccc(C(=O)O)c3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H24N2O4S/c1-19-10-12-21(13-11-19)27(32)30-23-14-16-25(17-15-23)36-26(20-6-3-2-4-7-20)28(33)31-24-9-5-8-22(18-24)29(34)35/h2-18,26H,1H3,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | KOFJGRIPGLPMHP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |