C27H20Cl2N2O2S — CID 23100750
3-chloro-N-[4-[2-(3-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 23100750) has the molecular formula C27H20Cl2N2O2S and a molecular weight of 507.44 g/mol. Its IUPAC name is 3-chloro-N-[4-[2-(3-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[2-(3-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 23100750 |
| Molecular Formula | C27H20Cl2N2O2S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 3-chloro-N-[4-[2-(3-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2cccc(Cl)c2)c2ccccc2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H20Cl2N2O2S/c28-20-9-4-8-19(16-20)26(32)30-22-12-14-24(15-13-22)34-25(18-6-2-1-3-7-18)27(33)31-23-11-5-10-21(29)17-23/h1-17,25H,(H,30,32)(H,31,33) |
| InChIKey | CGEAYATVIMJLIP-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |