C27H22ClN3O4S2 — CID 18904951
3-chloro-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide (PubChem CID 18904951) has the molecular formula C27H22ClN3O4S2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 3-chloro-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18904951 |
| Molecular Formula | C27H22ClN3O4S2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 3-chloro-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)c3cccc(Cl)c3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22ClN3O4S2/c28-20-9-4-8-19(16-20)26(32)31-22-10-5-11-23(17-22)36-25(18-6-2-1-3-7-18)27(33)30-21-12-14-24(15-13-21)37(29,34)35/h1-17,25H,(H,30,33)(H,31,32)(H2,29,34,35) |
| InChIKey | VWLMQVRAUCXODK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |