C20H17ClN2OS — CID 18894387
2-(3-aminophenyl)sulfanyl-N-(3-chlorophenyl)-2-phenylacetamide (PubChem CID 18894387) has the molecular formula C20H17ClN2OS and a molecular weight of 368.89 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(3-chlorophenyl)-2-phenylacetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(3-chlorophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 18894387 |
| Molecular Formula | C20H17ClN2OS |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(3-chlorophenyl)-2-phenylacetamide |
| SMILES | Nc1cccc(SC(C(=O)Nc2cccc(Cl)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H17ClN2OS/c21-15-8-4-10-17(12-15)23-20(24)19(14-6-2-1-3-7-14)25-18-11-5-9-16(22)13-18/h1-13,19H,22H2,(H,23,24) |
| InChIKey | XWKJVFKEHGXTRT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|