C20H17BrN2OS — CID 18894384
2-(3-aminophenyl)sulfanyl-N-(4-bromophenyl)-2-phenylacetamide (PubChem CID 18894384) has the molecular formula C20H17BrN2OS and a molecular weight of 413.34 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(4-bromophenyl)-2-phenylacetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(4-bromophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 18894384 |
| Molecular Formula | C20H17BrN2OS |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(4-bromophenyl)-2-phenylacetamide |
| SMILES | Nc1cccc(SC(C(=O)Nc2ccc(Br)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H17BrN2OS/c21-15-9-11-17(12-10-15)23-20(24)19(14-5-2-1-3-6-14)25-18-8-4-7-16(22)13-18/h1-13,19H,22H2,(H,23,24) |
| InChIKey | HOMQHEKQTSSCEK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|