C27H19BrCl2N2O2S — CID 18902302
N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2,4-dichlorobenzamide (PubChem CID 18902302) has the molecular formula C27H19BrCl2N2O2S and a molecular weight of 586.34 g/mol. Its IUPAC name is N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 18902302 |
| Molecular Formula | C27H19BrCl2N2O2S |
| Molecular Weight | 586.34 g/mol |
| Exact Mass | 583.97 |
| IUPAC Name | N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(Br)cc2)c2ccccc2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H19BrCl2N2O2S/c28-18-9-12-20(13-10-18)31-27(34)25(17-5-2-1-3-6-17)35-22-8-4-7-21(16-22)32-26(33)23-14-11-19(29)15-24(23)30/h1-16,25H,(H,31,34)(H,32,33) |
| InChIKey | FVHRNKXQWFPRFI-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.34 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |