C29H24Cl2N2O3S — CID 18902348
2,4-dichloro-N-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 18902348) has the molecular formula C29H24Cl2N2O3S and a molecular weight of 551.50 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18902348 |
| Molecular Formula | C29H24Cl2N2O3S |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 2,4-dichloro-N-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | CCOc1ccccc1NC(=O)C(Sc1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C29H24Cl2N2O3S/c1-2-36-26-14-7-6-13-25(26)33-29(35)27(19-9-4-3-5-10-19)37-22-12-8-11-21(18-22)32-28(34)23-16-15-20(30)17-24(23)31/h3-18,27H,2H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | CTDBWSKWSGWCQI-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |