C28H15Cl2F7N2O2S — CID 18902361
2,4-dichloro-N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide (PubChem CID 18902361) has the molecular formula C28H15Cl2F7N2O2S and a molecular weight of 647.40 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18902361 |
| Molecular Formula | C28H15Cl2F7N2O2S |
| Molecular Weight | 647.40 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | 2,4-dichloro-N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2ccccc2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H15Cl2F7N2O2S/c29-14-9-10-17(18(30)11-14)26(40)38-15-7-4-8-16(12-15)42-25(13-5-2-1-3-6-13)27(41)39-24-22(33)20(31)19(28(35,36)37)21(32)23(24)34/h1-12,25H,(H,38,40)(H,39,41) |
| InChIKey | NZKLHXLHVGQHDB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.40 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|