C30H20F7N3O2S2 — CID 19317394
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 19317394) has the molecular formula C30H20F7N3O2S2 and a molecular weight of 651.63 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19317394 |
| Molecular Formula | C30H20F7N3O2S2 |
| Molecular Weight | 651.63 g/mol |
| Exact Mass | 651.09 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H20F7N3O2S2/c1-15(41)16-10-12-18(13-11-16)38-29(43)39-19-8-5-9-20(14-19)44-27(17-6-3-2-4-7-17)28(42)40-26-24(33)22(31)21(30(35,36)37)23(32)25(26)34/h2-14,27H,1H3,(H,40,42)(H2,38,39,43) |
| InChIKey | IIJCVMYRXWEDOO-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.63 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|