C30H29N3OS2 — CID 19316794
N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide (PubChem CID 19316794) has the molecular formula C30H29N3OS2 and a molecular weight of 511.72 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 19316794 |
| Molecular Formula | C30H29N3OS2 |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=S)Nc2cccc(SC(C(=O)Nc3c(C)cccc3C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H29N3OS2/c1-20-15-17-24(18-16-20)31-30(35)32-25-13-8-14-26(19-25)36-28(23-11-5-4-6-12-23)29(34)33-27-21(2)9-7-10-22(27)3/h4-19,28H,1-3H3,(H,33,34)(H2,31,32,35) |
| InChIKey | PPYIAOOKSKLZDB-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|