C29H27N3OS2 — CID 19316485
N-(2,3-dimethylphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19316485) has the molecular formula C29H27N3OS2 and a molecular weight of 497.69 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316485 |
| Molecular Formula | C29H27N3OS2 |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | Cc1cccc(NC(=O)C(Sc2cccc(NC(=S)Nc3ccccc3)c2)c2ccccc2)c1C |
| InChI | InChI=1S/C29H27N3OS2/c1-20-11-9-18-26(21(20)2)32-28(33)27(22-12-5-3-6-13-22)35-25-17-10-16-24(19-25)31-29(34)30-23-14-7-4-8-15-23/h3-19,27H,1-2H3,(H,32,33)(H2,30,31,34) |
| InChIKey | ZRPIGRWOGWOBRF-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|