C23H16F7N3OS2 — CID 19712769
2-[4-(phenylcarbamothioylamino)phenyl]sulfanyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 19712769) has the molecular formula C23H16F7N3OS2 and a molecular weight of 547.52 g/mol. Its IUPAC name is 2-[4-(phenylcarbamothioylamino)phenyl]sulfanyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[4-(phenylcarbamothioylamino)phenyl]sulfanyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 19712769 |
| Molecular Formula | C23H16F7N3OS2 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 2-[4-(phenylcarbamothioylamino)phenyl]sulfanyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Sc1ccc(NC(=S)Nc2ccccc2)cc1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C23H16F7N3OS2/c1-11(21(34)33-20-18(26)16(24)15(23(28,29)30)17(25)19(20)27)36-14-9-7-13(8-10-14)32-22(35)31-12-5-3-2-4-6-12/h2-11H,1H3,(H,33,34)(H2,31,32,35) |
| InChIKey | BGBVVNOMIHUTPB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|