C19H19N5OS3 — CID 92528507
(2S)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide (PubChem CID 92528507) has the molecular formula C19H19N5OS3 and a molecular weight of 429.60 g/mol. Its IUPAC name is (2S)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide.
| Compound Name | (2S)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 92528507 |
| Molecular Formula | C19H19N5OS3 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (2S)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
| SMILES | Cc1nnc(NC(=O)[C@H](C)Sc2ccc(NC(=S)Nc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H19N5OS3/c1-12(17(25)22-19-24-23-13(2)28-19)27-16-10-8-15(9-11-16)21-18(26)20-14-6-4-3-5-7-14/h3-12H,1-2H3,(H2,20,21,26)(H,22,24,25)/t12-/m0/s1 |
| InChIKey | GYGZXLGECAQNNB-LBPRGKRZSA-N |
| XLogP | 4.77 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|