C31H26N4O2S2 — CID 19318279
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1H-indol-6-yl)-2-phenylacetamide (PubChem CID 19318279) has the molecular formula C31H26N4O2S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1H-indol-6-yl)-2-phenylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1H-indol-6-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19318279 |
| Molecular Formula | C31H26N4O2S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1H-indol-6-yl)-2-phenylacetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C(=O)Nc3ccc4cc[nH]c4c3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H26N4O2S2/c1-20(36)21-10-13-24(14-11-21)34-31(38)35-25-8-5-9-27(18-25)39-29(23-6-3-2-4-7-23)30(37)33-26-15-12-22-16-17-32-28(22)19-26/h2-19,29,32H,1H3,(H,33,37)(H2,34,35,38) |
| InChIKey | RECAECPIFSAOGZ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|