C29H24N4OS2 — CID 19318063
N-(1H-indol-6-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19318063) has the molecular formula C29H24N4OS2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-(1H-indol-6-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(1H-indol-6-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19318063 |
| Molecular Formula | C29H24N4OS2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-(1H-indol-6-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(Nc1ccc2cc[nH]c2c1)C(Sc1cccc(NC(=S)Nc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H24N4OS2/c34-28(31-24-15-14-20-16-17-30-26(20)19-24)27(21-8-3-1-4-9-21)36-25-13-7-12-23(18-25)33-29(35)32-22-10-5-2-6-11-22/h1-19,27,30H,(H,31,34)(H2,32,33,35) |
| InChIKey | UQSJRQOSVRMKAQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|