C39H32N4O4S — CID 19320025
N-[(E)-3-[3-[2-(1H-indol-6-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19320025) has the molecular formula C39H32N4O4S and a molecular weight of 652.78 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(1H-indol-6-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(1H-indol-6-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320025 |
| Molecular Formula | C39H32N4O4S |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | N-[(E)-3-[3-[2-(1H-indol-6-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc3cc[nH]c3c2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H32N4O4S/c1-47-35-18-9-8-15-29(35)23-34(43-37(44)28-13-6-3-7-14-28)38(45)41-30-16-10-17-32(24-30)48-36(27-11-4-2-5-12-27)39(46)42-31-20-19-26-21-22-40-33(26)25-31/h2-25,36,40H,1H3,(H,41,45)(H,42,46)(H,43,44)/b34-23+ |
| InChIKey | AJFFMDCVCVCHRH-PPFNPFNJSA-N |
| XLogP | 8.06 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|