C35H32N4O5S — CID 19319611
N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319611) has the molecular formula C35H32N4O5S and a molecular weight of 620.73 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319611 |
| Molecular Formula | C35H32N4O5S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)Nc3ccc4cc[nH]c4c3)c2)c(OC)c1 |
| InChI | InChI=1S/C35H32N4O5S/c1-22(33(40)37-27-14-12-23-16-17-36-30(23)20-27)45-29-11-7-10-26(19-29)38-35(42)31(39-34(41)24-8-5-4-6-9-24)18-25-13-15-28(43-2)21-32(25)44-3/h4-22,36H,1-3H3,(H,37,40)(H,38,42)(H,39,41)/b31-18+ |
| InChIKey | CXAUOEOSGMRAPD-FDAWAROLSA-N |
| XLogP | 6.71 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|