C34H31N3O7S — CID 19307668
3-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 19307668) has the molecular formula C34H31N3O7S and a molecular weight of 625.70 g/mol. Its IUPAC name is 3-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 3-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 19307668 |
| Molecular Formula | C34H31N3O7S |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 3-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)Nc3cccc(C(=O)O)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C34H31N3O7S/c1-21(31(38)35-25-12-7-11-24(17-25)34(41)42)45-28-14-8-13-26(19-28)36-33(40)29(37-32(39)22-9-5-4-6-10-22)18-23-15-16-27(43-2)20-30(23)44-3/h4-21H,1-3H3,(H,35,38)(H,36,40)(H,37,39)(H,41,42)/b29-18+ |
| InChIKey | ILSWAXAVXSAUQE-RDRPBHBLSA-N |
| XLogP | 5.93 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|