C38H33N3O4S — CID 22186779
N-[(Z)-1-(2-methoxyphenyl)-3-[4-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22186779) has the molecular formula C38H33N3O4S and a molecular weight of 627.77 g/mol. Its IUPAC name is N-[(Z)-1-(2-methoxyphenyl)-3-[4-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-methoxyphenyl)-3-[4-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22186779 |
| Molecular Formula | C38H33N3O4S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | N-[(Z)-1-(2-methoxyphenyl)-3-[4-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2cccc(C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H33N3O4S/c1-26-12-11-18-31(24-26)40-38(44)35(27-13-5-3-6-14-27)46-32-22-20-30(21-23-32)39-37(43)33(25-29-17-9-10-19-34(29)45-2)41-36(42)28-15-7-4-8-16-28/h3-25,35H,1-2H3,(H,39,43)(H,40,44)(H,41,42)/b33-25- |
| InChIKey | UNKHTYJXQNKVHO-IVQJCJPDSA-N |
| XLogP | 7.89 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|