C31H23BrN2O2S — CID 18908350
N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 18908350) has the molecular formula C31H23BrN2O2S and a molecular weight of 567.51 g/mol. Its IUPAC name is N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18908350 |
| Molecular Formula | C31H23BrN2O2S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | N-[3-[2-(4-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(Br)cc2)c2ccccc2)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H23BrN2O2S/c32-25-15-17-26(18-16-25)33-31(36)29(22-8-2-1-3-9-22)37-28-12-6-11-27(20-28)34-30(35)24-14-13-21-7-4-5-10-23(21)19-24/h1-20,29H,(H,33,36)(H,34,35) |
| InChIKey | UJFOSUCPTLQKEZ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |