C30H24N2O2S — CID 18908164
N-[3-[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 18908164) has the molecular formula C30H24N2O2S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[3-[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18908164 |
| Molecular Formula | C30H24N2O2S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[3-[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | CC(Sc1cccc(NC(=O)c2ccc3ccccc3c2)c1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H24N2O2S/c1-20(29(33)31-27-16-15-22-8-3-5-10-24(22)18-27)35-28-12-6-11-26(19-28)32-30(34)25-14-13-21-7-2-4-9-23(21)17-25/h2-20H,1H3,(H,31,33)(H,32,34) |
| InChIKey | YJNFOGDACCLQPG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |