C32H24N2O2S2 — CID 19318602
N-[3-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 19318602) has the molecular formula C32H24N2O2S2 and a molecular weight of 532.69 g/mol. Its IUPAC name is N-[3-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 19318602 |
| Molecular Formula | C32H24N2O2S2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[3-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | CC(Sc1cccc(NC(=O)c2ccc3ccccc3c2)c1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C32H24N2O2S2/c1-21(32(36)34-27-13-4-6-15-29(27)38-30-16-7-5-14-28(30)34)37-26-12-8-11-25(20-26)33-31(35)24-18-17-22-9-2-3-10-23(22)19-24/h2-21H,1H3,(H,33,35) |
| InChIKey | DRLGBUMGZQHAFX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |