C33H26N2O2S2 — CID 19318629
N-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 19318629) has the molecular formula C33H26N2O2S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is N-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 19318629 |
| Molecular Formula | C33H26N2O2S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | N-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc3ccccc3c2)c1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C33H26N2O2S2/c1-2-29(33(37)35-27-14-5-7-16-30(27)39-31-17-8-6-15-28(31)35)38-26-13-9-12-25(21-26)34-32(36)24-19-18-22-10-3-4-11-23(22)20-24/h3-21,29H,2H2,1H3,(H,34,36) |
| InChIKey | QBHRPFXAHZQDQB-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |