C30H26N2O3S2 — CID 21168004
N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]-2-phenoxyacetamide (PubChem CID 21168004) has the molecular formula C30H26N2O3S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 21168004 |
| Molecular Formula | C30H26N2O3S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]-2-phenoxyacetamide |
| SMILES | CCC(Sc1ccc(NC(=O)COc2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C30H26N2O3S2/c1-2-26(30(34)32-24-12-6-8-14-27(24)37-28-15-9-7-13-25(28)32)36-23-18-16-21(17-19-23)31-29(33)20-35-22-10-4-3-5-11-22/h3-19,26H,2,20H2,1H3,(H,31,33) |
| InChIKey | AJBDBPHAFWZQMJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |