C25H22N2O4S2 — CID 22784623
4-oxo-4-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]butanoic acid (PubChem CID 22784623) has the molecular formula C25H22N2O4S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-oxo-4-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]butanoic acid.
| Compound Name | 4-oxo-4-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]butanoic acid |
|---|---|
| PubChem CID | 22784623 |
| Molecular Formula | C25H22N2O4S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-oxo-4-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]butanoic acid |
| SMILES | CC(Sc1ccc(NC(=O)CCC(=O)O)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C25H22N2O4S2/c1-16(32-18-12-10-17(11-13-18)26-23(28)14-15-24(29)30)25(31)27-19-6-2-4-8-21(19)33-22-9-5-3-7-20(22)27/h2-13,16H,14-15H2,1H3,(H,26,28)(H,29,30) |
| InChIKey | OCBLOXRTOLWFCU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |