C26H26N2O2S2 — CID 23095726
N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]pentanamide (PubChem CID 23095726) has the molecular formula C26H26N2O2S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]pentanamide.
| Compound Name | N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 23095726 |
| Molecular Formula | C26H26N2O2S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SC(C)C(=O)N2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N2O2S2/c1-3-4-13-25(29)27-19-14-16-20(17-15-19)31-18(2)26(30)28-21-9-5-7-11-23(21)32-24-12-8-6-10-22(24)28/h5-12,14-18H,3-4,13H2,1-2H3,(H,27,29) |
| InChIKey | SFIXHPGIIZNUHS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |