C28H23N3OS3 — CID 19712999
1-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]-3-phenylthiourea (PubChem CID 19712999) has the molecular formula C28H23N3OS3 and a molecular weight of 513.71 g/mol. Its IUPAC name is 1-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]-3-phenylthiourea.
| Compound Name | 1-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 19712999 |
| Molecular Formula | C28H23N3OS3 |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 1-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]-3-phenylthiourea |
| SMILES | CC(Sc1ccc(NC(=S)Nc2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C28H23N3OS3/c1-19(27(32)31-23-11-5-7-13-25(23)35-26-14-8-6-12-24(26)31)34-22-17-15-21(16-18-22)30-28(33)29-20-9-3-2-4-10-20/h2-19H,1H3,(H2,29,30,33) |
| InChIKey | VCDANNLUCLJKPR-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|