C28H21ClN2O2S2 — CID 21167207
3-chloro-N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]benzamide (PubChem CID 21167207) has the molecular formula C28H21ClN2O2S2 and a molecular weight of 517.08 g/mol. Its IUPAC name is 3-chloro-N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21167207 |
| Molecular Formula | C28H21ClN2O2S2 |
| Molecular Weight | 517.08 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 3-chloro-N-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylphenyl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)c2cccc(Cl)c2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C28H21ClN2O2S2/c1-18(28(33)31-23-9-2-4-11-25(23)35-26-12-5-3-10-24(26)31)34-22-15-13-21(14-16-22)30-27(32)19-7-6-8-20(29)17-19/h2-18H,1H3,(H,30,32) |
| InChIKey | FWQKVZNXLROCJT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.08 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |