C29H23N3O4S2 — CID 21169066
3-nitro-N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]benzamide (PubChem CID 21169066) has the molecular formula C29H23N3O4S2 and a molecular weight of 541.65 g/mol. Its IUPAC name is 3-nitro-N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]benzamide.
| Compound Name | 3-nitro-N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21169066 |
| Molecular Formula | C29H23N3O4S2 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 3-nitro-N-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C29H23N3O4S2/c1-2-25(29(34)31-23-10-3-5-12-26(23)38-27-13-6-4-11-24(27)31)37-22-16-14-20(15-17-22)30-28(33)19-8-7-9-21(18-19)32(35)36/h3-18,25H,2H2,1H3,(H,30,33) |
| InChIKey | HDMUVQWSFPBTAB-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|