C24H20ClN3O6S — CID 18905160
2-chloro-5-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid (PubChem CID 18905160) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is 2-chloro-5-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18905160 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 2-chloro-5-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H20ClN3O6S/c1-2-21(23(30)27-16-9-10-20(25)19(13-16)24(31)32)35-18-8-4-6-15(12-18)26-22(29)14-5-3-7-17(11-14)28(33)34/h3-13,21H,2H2,1H3,(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | CKEAIWGZJPMUSD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|